Systematic / IUPAC Name: 2-Methyl-5-nitroaniline
ID: Reference7466
Other Names:
Diabase scarlet G;
Fast red SG base;
Fast scarlet G;
Lithosol orange R base;
Mitsui scarlet G base
; more
Formula: C7H8N2O2
Class: Extractables/Leachables
5-Nitro-o-toluidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 137 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 10:50:47 AM |
| InChI | InChI=1S/C7H8N2O2/c1-5-2-3-6(9(10)11)4-7(5)8/h2-4H,8H2,1H3 |
| InChI Key | DSBIJCMXAIKKKI-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | 99558 |
| Splash | |
| Other Names |
Diabase scarlet G; Fast red SG base; Fast scarlet G; Lithosol orange R base; Mitsui scarlet G base; Naphthanil scarlet G base; Naphtoelan fast scarlet G base; PNOT; (2-Methyl-5-nitrophenyl)amine; 2-Amino-4-nitrotoluene; 2-Methyl-5-nitro-aniline; 2-Methyl-5-nitrobenzenamine; 2-Methyl-5-nitrophenylamine; Benzenamine, 2-methyl-5-nitro- |
| PubChem | 7444 |
| KEGG | C16398 |
| ChemIDPlus | 000099558 |
| ChemSpider | 7166 |
| ChEBI | CHEBI:66891 |
| ChEMBL | CHEMBL324642 |