Systematic / IUPAC Name: Benzene-1,4-diamine
ID: Reference7468
Other Names:
p-Fenylendiamin;
Basf ursol D;
Benzofur D;
Durafur black R;
Fouramine D
; more
Formula: C6H8N2
Class: Extractables/Leachables
p-Phenylenediamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 212 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 10:52:19 AM |
| InChI | InChI=1S/C6H8N2/c7-5-1-2-6(8)4-3-5/h1-4H,7-8H2 |
| InChI Key | CBCKQZAAMUWICA-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1N)N |
| CAS | 106503 |
| Splash | |
| Other Names |
p-Fenylendiamin; Basf ursol D; Benzofur D; Durafur black R; Fouramine D; Fourrine 1; Fur black 41866; Fur black 41867; Fur brown 41866; Fur yellow; Furro D; Futramine D; Nako H; Orsin; Pelagol D; Pelagol grey D; Peltol D; Renal PF; Rodol D; Santoflex LC; Tertral D; Ursol D; Zoba black D; p-Aminoaniline; p-Benzenediamine; p-Diaminobenzene; p-Phenyldiamine; p-Phenylene diamine; 1,4-Benzenediamine; 1,4-Diaminobenzene; 1,4-Phenylenediamine; 4-Aminoaniline; 4-Aminophenylamine; 4-Phenylenediamine; Aminogen II; Paraphenylen-diamine; Paraphenylenediamine; Phenylenediamine, p- |
| PubChem | 7814 |
| ChemSpider | 13835179 |
| Wikipedia | P-Phenylenediamine |
| ChEBI | CHEBI:51403 |
| ChEMBL | CHEMBL403741 |
| KEGG | C19499 |