Systematic / IUPAC Name: 9a-Hydroxy-3,8a-dimethyl-5-methylene-2-oxo-2,4,4a,5,6,7,8,8a,9,9a-decahydronaphtho[2,3-b]furan-8-yl acetate
ID: Reference7472
Other Names: Naphtho[2,3-b]furan-2(4H)-one, 8-(acetyloxy)-4a,5,6,7,8,8a,9,9a-octahydro-9a-hydroxy-3,8a-dimethyl-5-methylene-
Formula: C17H22O5
9a-Hydroxy-3,8a-dimethyl-5-methylene-2-oxo-2,4,4a,5,6,7,8,8a,9,9a-decahydronaphtho[2,3-b]furan-8-yl acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/28/2018 1:56:46 PM |
| InChI | InChI=1S/C17H22O5/c1-9-5-6-14(21-11(3)18)16(4)8-17(20)13(7-12(9)16)10(2)15(19)22-17/h12,14,20H,1,5-8H2,2-4H3 |
| InChI Key | DDHXERAMOVJOAJ-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C2CC3C(=C)CCC(C3(CC2(OC1=O)O)C)OC(=O)C |
| CAS | |
| Splash | |
| Other Names | Naphtho[2,3-b]furan-2(4H)-one, 8-(acetyloxy)-4a,5,6,7,8,8a,9,9a-octahydro-9a-hydroxy-3,8a-dimethyl-5-methylene- |