Systematic / IUPAC Name: 2-Methylbenzene-1,3-diamine
ID: Reference7475
Other Names:
2,6-Toluylenediamine;
2,6-Tolylenediamine;
(3-Amino-2-methyl-phenyl)amine;
1,3-Benzenediamine, 2-methyl-;
2,6-Diamino toluene
; more
Formula: C7H10N2
Class: Extractables/Leachables
2,6-Diaminotoluene mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 253 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 10:53:59 AM |
| InChI | InChI=1S/C7H10N2/c1-5-6(8)3-2-4-7(5)9/h2-4H,8-9H2,1H3 |
| InChI Key | RLYCRLGLCUXUPO-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=CC=C1N)N |
| CAS | 823405 |
| Splash | |
| Other Names |
2,6-Toluylenediamine; 2,6-Tolylenediamine; (3-Amino-2-methyl-phenyl)amine; 1,3-Benzenediamine, 2-methyl-; 2,6-Diamino toluene; 2,6-Diamino-1-methylbenzene; 2,6-Toluenediamine; 2-Methyl-m-phenylenediamine; 2-Methyl-1,3-benzenediamine; 2-Methyl-1,3-phenylenediamine; Toluene, 2,6-diamino-; Toluene-2,6-diamine; 2,6-DAT |
| ChemIDPlus | 000823405 |
| PubChem | 13205 |
| ChemSpider | 12650 |
| ChEBI | CHEBI:76288 |
| ChEMBL | CHEMBL1489438 |
| HMDb | HMDB41801 |
| Wikipedia | 2,6-Diaminotoluol (DE) |