Systematic / IUPAC Name: 3-[2-(1,3-Benzodioxol-5-yl)-7-methoxy-1-benzofuran-5-yl]-3-hydroxypropyl hexopyranoside
ID: Reference7479
Other Names: Hexopyranoside, 3-[2-(1,3-benzodioxol-5-yl)-7-methoxy-5-benzofuranyl]-3-hydroxypropyl
Formula: C25H28O11
3-[2-(1,3-Benzodioxol-5-yl)-7-methoxy-1-benzofuran-5-yl]-3-hydroxypropyl hexopyranoside mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 772 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/2/2018 12:28:38 PM |
| InChI | InChI=1S/C25H28O11/c1-31-19-8-13(15(27)4-5-32-25-23(30)22(29)21(28)20(10-26)36-25)6-14-9-17(35-24(14)19)12-2-3-16-18(7-12)34-11-33-16/h2-3,6-9,15,20-23,25-30H,4-5,10-11H2,1H3 |
| InChI Key | ZLACPIJRVKLLJM-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C2C(=CC(=C1)C(CCOC3C(C(C(C(O3)CO)O)O)O)O)C=C(O2)C4=CC5=C(C=C4)OCO5 |
| CAS | |
| Splash | |
| Other Names | Hexopyranoside, 3-[2-(1,3-benzodioxol-5-yl)-7-methoxy-5-benzofuranyl]-3-hydroxypropyl |