Systematic / IUPAC Name: (5E)-4-Methoxy-5-{methoxy-[(2R,3S)-3-phenyloxiran-2-yl]methylidene}furan-2-one
ID: Reference7494
Other Names: 2(5H)-Furanone, 4-methoxy-5-{methoxy[(2R,3S)-3-phenyloxiranyl]methylene}-, (5E)-
Formula: C15H14O5
(5E)-4-Methoxy-5-{methoxy[(2R,3S)-3-phenyl-2-oxiranyl]methylene}-2(5H)-furanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/8/2018 1:54:43 PM |
| InChI | InChI=1S/C15H14O5/c1-17-10-8-11(16)19-13(10)14(18-2)15-12(20-15)9-6-4-3-5-7-9/h3-8,12,15H,1-2H3/b14-13+/t12-,15+/m0/s1 |
| InChI Key | RTNGMIUMJUOABT-ONKYJICLSA-N |
| Canonical SMILES | COC1=CC(=O)OC1=C(C2C(O2)C3=CC=CC=C3)OC |
| CAS | |
| Splash | |
| Other Names | 2(5H)-Furanone, 4-methoxy-5-{methoxy[(2R,3S)-3-phenyloxiranyl]methylene}-, (5E)- |