Systematic / IUPAC Name: 2-Methoxy-N-phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]acetamide
ID: Reference7499
Other Names:
2-Methoxy-N-(1-phenethylpiperidin-4-yl)-N-phenylacetamide;
Acetamide, 2-methoxy-N-phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]-
Formula: C22H28N2O2
Methoxyacetyl fentanyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/9/2018 12:01:54 PM |
| InChI | InChI=1S/C22H28N2O2/c1-26-18-22(25)24(20-10-6-3-7-11-20)21-13-16-23(17-14-21)15-12-19-8-4-2-5-9-19/h2-11,21H,12-18H2,1H3 |
| InChI Key | SADNVKRDSWWFTK-UHFFFAOYSA-N |
| Canonical SMILES | COCC(=O)N(C1CCN(CC1)CCC2=CC=CC=C2)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names |
2-Methoxy-N-(1-phenethylpiperidin-4-yl)-N-phenylacetamide; Acetamide, 2-methoxy-N-phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]- |
| ChEMBL | CHEMBL1740467 |
| PubChem | 968688 |
| ChemSpider | 838859 |
| Wikipedia | Methoxyacetylfentanyl |