Systematic / IUPAC Name: N-[(3R,4R)-3-Methyl-1-(2-phenylethyl)-4-piperidinyl]-N-phenylbutanamide
ID: Reference7506
Other Names: Butanamide, N-[(3R,4R)-3-methyl-1-(2-phenylethyl)-4-piperidinyl]-N-phenyl-
Formula: C24H32N2O
(+/-)-cis-3-Methyl butyryl fentanyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/9/2018 2:14:34 PM |
| InChI | InChI=1S/C24H32N2O/c1-3-10-24(27)26(22-13-8-5-9-14-22)23-16-18-25(19-20(23)2)17-15-21-11-6-4-7-12-21/h4-9,11-14,20,23H,3,10,15-19H2,1-2H3/t20-,23-/m1/s1 |
| InChI Key | ZPAOSKLOFZWBLS-NFBKMPQASA-N |
| Canonical SMILES | CCCC(=O)N(C1CCN(CC1C)CCC2=CC=CC=C2)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | Butanamide, N-[(3R,4R)-3-methyl-1-(2-phenylethyl)-4-piperidinyl]-N-phenyl- |