Systematic / IUPAC Name: Methyl 2-{[2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy}benzoate
ID: Reference7510
Other Names: Benzoic acid, 2-{[2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy}, methyl ester
Formula: C20H28O12
Methyl 2-{[2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy}benzoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 3 |
| No. of Spectra | 3111 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/12/2018 8:57:05 AM |
| InChI | InChI=1S/C20H28O12/c1-8-12(22)14(24)16(26)19(29-8)32-17-15(25)13(23)11(7-21)31-20(17)30-10-6-4-3-5-9(10)18(27)28-2/h3-6,8,11-17,19-26H,7H2,1-2H3/t8-,11+,12-,13+,14+,15-,16+,17+,19-,20+/m0/s1 |
| InChI Key | IPEXIFXOBNTVCE-HXPJHFNISA-N |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC=CC=C3C(=O)OC)CO)O)O)O)O)O |
| CAS | |
| Splash | |
| Other Names | Benzoic acid, 2-{[2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy}, methyl ester |