Systematic / IUPAC Name: 3,5-Dihydroxy-4-[3-(4-hydroxyphenyl)propanoyl]phenyl 6-O-(3,4,5-trihydroxybenzoyl)-β-D-glucopyranoside
ID: Reference7515
Other Names: 1-Propanone, 1-(2,6-dihydroxy-4-{[6-O-(3,4,5-trihydroxybenzoyl)-β-D-glucopyranosyl]oxy}phenyl)-3-(4-hydroxyphenyl)-
Formula: C28H28O14
3,5-Dihydroxy-4-[3-(4-hydroxyphenyl)propanoyl]phenyl 6-O-(3,4,5-trihydroxybenzoyl)-β-D-glucopyranoside mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/12/2018 11:41:13 AM |
| InChI | InChI=1S/C28H28O14/c29-14-4-1-12(2-5-14)3-6-16(30)22-17(31)9-15(10-18(22)32)41-28-26(38)25(37)24(36)21(42-28)11-40-27(39)13-7-19(33)23(35)20(34)8-13/h1-2,4-5,7-10,21,24-26,28-29,31-38H,3,6,11H2/t21-,24-,25+,26-,28-/m1/s1 |
| InChI Key | YPFUHFNAEWURDN-ZKPBLSLZSA-N |
| Canonical SMILES | C1=CC(=CC=C1CCC(=O)C2=C(C=C(C=C2O)OC3C(C(C(C(O3)COC(=O)C4=CC(=C(C(=C4)O)O)O)O)O)O)O)O |
| CAS | |
| Splash | |
| Other Names | 1-Propanone, 1-(2,6-dihydroxy-4-{[6-O-(3,4,5-trihydroxybenzoyl)-β-D-glucopyranosyl]oxy}phenyl)-3-(4-hydroxyphenyl)- |