Systematic / IUPAC Name: {3-[2-Cyano-3-(trifluoromethyl)phenoxy]phenyl} 4,4,4-trifluorobutane-1-sulfonate
ID: Reference7516
Other Names:
1-Butanesulfonic acid, 4,4,4-trifluoro-, 3-[2-cyano-3-(trifluoromethyl)phenoxy]phenyl ester;
3-[2-Cyano-3-(trifluoromethyl)phenoxy]phenyl 4,4,4-trifluoro-1-butanesulfonic acid ester;
3-[2-Cyano-3-(trifluoromethyl)phenoxy]phenyl 4,4,4-trifluorobutane-1-sulfonate;
BAY-59-3074
Formula: C18H13F6NO4S
BAY 59-3074 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 232 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/12/2018 1:48:05 PM |
| InChI | InChI=1S/C18H13F6NO4S/c19-17(20,21)8-3-9-30(26,27)29-13-5-1-4-12(10-13)28-16-7-2-6-15(14(16)11-25)18(22,23)24/h1-2,4-7,10H,3,8-9H2 |
| InChI Key | LWUSZIVDPJPVBW-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC(=C1)OS(=O)(=O)CCCC(F)(F)F)OC2=CC=CC(=C2C#N)C(F)(F)F |
| CAS | 406205741 |
| Splash | |
| Other Names |
1-Butanesulfonic acid, 4,4,4-trifluoro-, 3-[2-cyano-3-(trifluoromethyl)phenoxy]phenyl ester; 3-[2-Cyano-3-(trifluoromethyl)phenoxy]phenyl 4,4,4-trifluoro-1-butanesulfonic acid ester; 3-[2-Cyano-3-(trifluoromethyl)phenoxy]phenyl 4,4,4-trifluorobutane-1-sulfonate; BAY-59-3074 |
| Wikipedia | BAY_59-3074 |
| ChemSpider | 8654468 |
| ChEBI | CHEBI:92339 |
| PubChem | 10479060 |
| ChEMBL | CHEMBL1354658 |