Systematic / IUPAC Name: 2-[(1R,5S,7R,8S,10S)-5,10-Dimethyl-4-oxo-11-oxatricyclo[6.2.1.01,5]undec-7-yl]acrylic acid
ID: Reference7522
Other Names:
1H-3a,6-Epoxyazulene-7-acetic acid, octahydro-4,8a-dimethyl-α-methylene-1-oxo-, (3aR,4S,6S,7R,8aS)- ;
2-[(1R,5S,7R,8S,10S)-5,10-dimethyl-4-oxo-11-oxatricyclo[6.2.1.0¹,5]undecan-7-yl]prop-2-enoic acid
Formula: C15H20O4
Ambrosic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 3 |
| No. of Spectra | 6447 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/13/2018 9:14:51 AM |
| InChI | InChI=1S/C15H20O4/c1-8-6-11-10(9(2)13(17)18)7-14(3)12(16)4-5-15(8,14)19-11/h8,10-11H,2,4-7H2,1,3H3,(H,17,18)/t8-,10+,11-,14+,15+/m0/s1 |
| InChI Key | ZONXEWIGPLHXNT-ULEBWITMSA-N |
| Canonical SMILES | CC1CC2C(CC3(C1(O2)CCC3=O)C)C(=C)C(=O)O |
| CAS | |
| Splash | |
| Other Names |
1H-3a,6-Epoxyazulene-7-acetic acid, octahydro-4,8a-dimethyl-α-methylene-1-oxo-, (3aR,4S,6S,7R,8aS)- ; 2-[(1R,5S,7R,8S,10S)-5,10-dimethyl-4-oxo-11-oxatricyclo[6.2.1.0¹,5]undecan-7-yl]prop-2-enoic acid |