Systematic / IUPAC Name: 2'-O-Acetyl-3'-O-(2,4-dimethoxy-6-methylbenzoyl)uridine
ID: Reference7527
Other Names:
Kioukasin A;
Uridine, 2'-acetate 3'-(2,4-dimethoxy-6-methylbenzoate);
(2R,3R,4R,5R)-4-(Acetyloxy)-5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl 2,4-dimethoxy-6-methylbenzoate
Formula: C21H24N2O10
2'-O-Acetyl-3'-O-(2,4-dimethoxy-6-methylbenzoyl)uridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/13/2018 12:00:12 PM |
| InChI | InChI=1S/C21H24N2O10/c1-10-7-12(29-3)8-13(30-4)16(10)20(27)33-17-14(9-24)32-19(18(17)31-11(2)25)23-6-5-15(26)22-21(23)28/h5-8,14,17-19,24H,9H2,1-4H3,(H,22,26,28)/t14-,17-,18-,19-/m1/s1 |
| InChI Key | MAWCJLLSYLMLHT-UTRMSSBJSA-N |
| Canonical SMILES | CC1=CC(=CC(=C1C(=O)OC2C(OC(C2OC(=O)C)N3C=CC(=O)NC3=O)CO)OC)OC |
| CAS | |
| Splash | |
| Other Names |
Kioukasin A; Uridine, 2'-acetate 3'-(2,4-dimethoxy-6-methylbenzoate); (2R,3R,4R,5R)-4-(Acetyloxy)-5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl 2,4-dimethoxy-6-methylbenzoate |