Systematic / IUPAC Name: 1,7,7-Trimethyl-2-oxo-3-oxabicyclo[2.2.1]heptane-4-carboxylic acid
ID: Reference7528
Other Names:
(1S)-(-)-Camphanic acid;
4,7,7-Trimethyl(2-oxabicyclo[2.2.1]hept-1-yl)carboxylic acid ;
4,7,7-Trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylic acid;
4,7,7-Trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptanecarboxylic acid
Formula: C10H14O4
(-)-Camphanic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 721 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/13/2018 12:59:35 PM |
| InChI | InChI=1S/C10H14O4/c1-8(2)9(3)4-5-10(8,6(11)12)14-7(9)13/h4-5H2,1-3H3,(H,11,12) |
| InChI Key | KPWKPGFLZGMMFX-UHFFFAOYSA-N |
| Canonical SMILES | CC1(C2(CCC1(OC2=O)C(=O)O)C)C |
| CAS | |
| Splash | |
| Other Names |
(1S)-(-)-Camphanic acid; 4,7,7-Trimethyl(2-oxabicyclo[2.2.1]hept-1-yl)carboxylic acid ; 4,7,7-Trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylic acid; 4,7,7-Trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptanecarboxylic acid |