Systematic / IUPAC Name: [(2R,3S,4R,5R)-5-(2,4-Dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] 2,4-dimethoxy-6-methylbenzoate
ID: Reference7529
Other Names:
Kioukasin D;
Uridine, 3'-(2,4-dimethoxy-6-methylbenzoate)
Formula: C19H22N2O9
3'-O-(2,4-Dimethoxy-6-methylbenzoyl)uridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/13/2018 12:53:36 PM |
| InChI | InChI=1S/C19H22N2O9/c1-9-6-10(27-2)7-11(28-3)14(9)18(25)30-16-12(8-22)29-17(15(16)24)21-5-4-13(23)20-19(21)26/h4-7,12,15-17,22,24H,8H2,1-3H3,(H,20,23,26)/t12-,15-,16-,17-/m1/s1 |
| InChI Key | LQYPUZKOEZWGBX-BASLNEPJSA-N |
| Canonical SMILES | CC1=CC(=CC(=C1C(=O)OC2C(OC(C2O)N3C=CC(=O)NC3=O)CO)OC)OC |
| CAS | |
| Splash | |
| Other Names |
Kioukasin D; Uridine, 3'-(2,4-dimethoxy-6-methylbenzoate) |