Systematic / IUPAC Name: (2E)-4-Hydroxy-4-{4-hydroxy-2-[(1E)-6-hydroxy-1-hepten-1-yl]cyclopentyl}-2-butenoic acid
ID: Reference7531
Other Names:
2-Butenoic acid, 4-hydroxy-4-{4-hydroxy-2-[(1E)-6-hydroxy-1-hepten-1-yl]cyclopentyl}-, (2E)- ;
(2E)-4-Hydroxy-4-{4-hydroxy-2-[(1E)-6-hydroxyhept-1-en-1-yl]cyclopentyl}but-2-enoic acid
Formula: C16H26O5
(2E)-4-Hydroxy-4-{4-hydroxy-2-[(1E)-6-hydroxy-1-hepten-1-yl]cyclopentyl}-2-butenoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 112 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/13/2018 1:49:59 PM |
| InChI | InChI=1S/C16H26O5/c1-11(17)5-3-2-4-6-12-9-13(18)10-14(12)15(19)7-8-16(20)21/h4,6-8,11-15,17-19H,2-3,5,9-10H2,1H3,(H,20,21)/b6-4+,8-7+ |
| InChI Key | JFMRAARESGPLQF-GFGVWQOPSA-N |
| Canonical SMILES | CC(CCCC=CC1CC(CC1C(C=CC(=O)O)O)O)O |
| CAS | |
| Splash | |
| Other Names |
2-Butenoic acid, 4-hydroxy-4-{4-hydroxy-2-[(1E)-6-hydroxy-1-hepten-1-yl]cyclopentyl}-, (2E)- ; (2E)-4-Hydroxy-4-{4-hydroxy-2-[(1E)-6-hydroxyhept-1-en-1-yl]cyclopentyl}but-2-enoic acid |