Systematic / IUPAC Name: 4-Oxo-4-[(3-oxo-2-decanyl)amino]butanoic acid
ID: Reference7598
Other Names: Butanoic acid, 4-[(1-methyl-2-oxononyl)amino]-4-oxo-
Formula: C14H25NO4
4-Oxo-4-[(3-oxo-2-decanyl)amino]butanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/21/2018 7:58:11 AM |
| InChI | InChI=1S/C14H25NO4/c1-3-4-5-6-7-8-12(16)11(2)15-13(17)9-10-14(18)19/h11H,3-10H2,1-2H3,(H,15,17)(H,18,19) |
| InChI Key | DGBNCMKQNOJCFB-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCC(=O)C(C)NC(=O)CCC(=O)O |
| CAS | |
| Splash | |
| Other Names | Butanoic acid, 4-[(1-methyl-2-oxononyl)amino]-4-oxo- |