Systematic / IUPAC Name: 4-Amino-6-(2-methyl-2-propanyl)-3-(methylsulfanyl)-1,2,4-triazin-5(4H)-one
ID: Reference76
Other Names:
1,2,4-Triazin-5(4H)-one, 4-amino-6-(1,1-dimethylethyl)-3-(methylthio)-;
4-Amino-6-tert-butyl-3-(methylthio)-1,2,4-triazin-5-one;
3-Methylthio-4-amino-6-tert-butyl-1,2,4-triazin-5-one;
1,2,4-Triazin-5-one, 4-amino-6-tert-butyl-3-(methylthio)-;
4-Amino-6-tert-butyl-3-methylthio-as-triazin-5(4H)-one
; more
Formula: C8H14N4OS
Class: Pesticides/Herbicides
Metribuzin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 6 |
| No. of Spectra | 941 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 2/24/2015 1:21:44 PM |
| InChI | InChI=1S/C8H14N4OS/c1-8(2,3)5-6(13)12(9)7(14-4)11-10-5/h9H2,1-4H3 |
| InChI Key | FOXFZRUHNHCZPX-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)C1=NN=C(N(C1=O)N)SC |
| CAS | 21087649 |
| Splash | |
| Other Names |
1,2,4-Triazin-5(4H)-one, 4-amino-6-(1,1-dimethylethyl)-3-(methylthio)-; 4-Amino-6-tert-butyl-3-(methylthio)-1,2,4-triazin-5-one; 3-Methylthio-4-amino-6-tert-butyl-1,2,4-triazin-5-one; 1,2,4-Triazin-5-one, 4-amino-6-tert-butyl-3-(methylthio)-; 4-Amino-6-tert-butyl-3-methylthio-as-triazin-5(4H)-one; 4-Amino-6-tert-butyl-3-methylthio-1,2,4-triazin-5(4H)-one; 4-Amino-6-tert-butyl-3-methylsulfanyl-4H-[1,2,4]triazin-5-one; 4-Amino-6-tert-butyl-4,5-dihydro-3-methylthio-1,2,4-triazin-5-one; 4-Amino-6-(1,1-dimethylethyl)-3-(methylthio)-1,2,4-triazin-5(4H)-one; 4-Amino-6-tert-butyl-3-(methylsulfanyl)-1,2,4-triazin-5(4H)-one; Sencor; Metribuzine; Lexone; Zenkor; Sencorex; Senkor; Lexone DF; Sencor DF; Lexone 4L; Sencor 4F; Bay dic 1468; Sencorex LF |
| PubChem | 30479 |
| KEGG | C14332 |
| ChEMBL | CHEMBL1902519 |
| ChemIDPlus | 021087649; 110000061 |
| Wikipedia | Metribuzin |
| ChemSpider | 28287 |