Systematic / IUPAC Name: 4-Amino-2-hydroxy-5-[[1-hydroxy-1-(5-oxo-6-bicyclo[4.1.0]hept-3-enyl)propan-2-yl]amino]-5-oxopentanoic acid
ID: Reference7600
Other Names: 4-Amino-2-hydroxy-4-[(1-hydroxy-1-{2-oxobicyclo[4.1.0]hept-3-en-1-yl}propan-2-yl)carbamoyl]butanoic acid
Formula: C15H22N2O6
4-Amino-2-hydroxy-5-{[1-hydroxy-1-(2-oxobicyclo[4.1.0]hept-3-en-1-yl)-2-propanyl]amino}-5-oxopentanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/21/2018 9:10:38 AM |
| InChI | InChI=1S/C15H22N2O6/c1-7(17-13(21)9(16)5-10(18)14(22)23)12(20)15-6-8(15)3-2-4-11(15)19/h2,4,7-10,12,18,20H,3,5-6,16H2,1H3,(H,17,21)(H,22,23) |
| InChI Key | SYGQXRLXOOXDRP-UHFFFAOYSA-N |
| Canonical SMILES | CC(C(C12CC1CC=CC2=O)O)NC(=O)C(CC(C(=O)O)O)N |
| CAS | |
| Splash | |
| Other Names | 4-Amino-2-hydroxy-4-[(1-hydroxy-1-{2-oxobicyclo[4.1.0]hept-3-en-1-yl}propan-2-yl)carbamoyl]butanoic acid |