Systematic / IUPAC Name: 2-Hydroxy-4-(4-hydroxyphenyl)butanoic acid
ID: Reference7617
Other Names: Benzenebutanoic acid, α,4-dihydroxy-
Formula: C10H12O4
2-Hydroxy-4-(4-hydroxyphenyl)butanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 625 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/26/2018 6:03:50 AM |
| InChI | InChI=1S/C10H12O4/c11-8-4-1-7(2-5-8)3-6-9(12)10(13)14/h1-2,4-5,9,11-12H,3,6H2,(H,13,14) |
| InChI Key | NDXWYVRAUFPPEJ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1CCC(C(=O)O)O)O |
| CAS | |
| Splash | |
| Other Names | Benzenebutanoic acid, α,4-dihydroxy- |