Systematic / IUPAC Name: 1-(1-Hydroxybutyl)-1,3,4,5,6,7-hexahydro-2-benzofuran-4,5,6,7-tetrol
ID: Reference7619
Other Names: 4,5,6,7-Isobenzofurantetrol, 1,3,4,5,6,7-hexahydro-1-(1-hydroxybutyl)-
Formula: C12H20O6
1-(1-Hydroxybutyl)-1,3,4,5,6,7-hexahydro-2-benzofuran-4,5,6,7-tetrol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 505 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/26/2018 6:08:00 AM |
| InChI | InChI=1S/C12H20O6/c1-2-3-6(13)12-7-5(4-18-12)8(14)10(16)11(17)9(7)15/h6,8-17H,2-4H2,1H3 |
| InChI Key | TWDKEWYUAIMHMA-UHFFFAOYSA-N |
| Canonical SMILES | CCCC(C1C2=C(CO1)C(C(C(C2O)O)O)O)O |
| CAS | |
| Splash | |
| Other Names | 4,5,6,7-Isobenzofurantetrol, 1,3,4,5,6,7-hexahydro-1-(1-hydroxybutyl)- |