Systematic / IUPAC Name: 3,5,7-Trihydroxy-2-(4-methoxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one
ID: Reference763
Other Names:
4H-1-Benzopyran-4-one, 3,5,7-trihydroxy-2-(4-methoxyphenyl)-8-(3-methyl-2-buten-1-yl)-;
Anhydroicaritin
Formula: C21H20O6
Class: Endogenous Metabolites Natural Products/Medicines
Icaritin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 75 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/5/2015 10:09:58 AM |
| InChI | InChI=1S/C21H20O6/c1-11(2)4-9-14-15(22)10-16(23)17-18(24)19(25)20(27-21(14)17)12-5-7-13(26-3)8-6-12/h4-8,10,22-23,25H,9H2,1-3H3 |
| InChI Key | TUUXBSASAQJECY-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | 118525409 |
| Splash | |
| Other Names |
4H-1-Benzopyran-4-one, 3,5,7-trihydroxy-2-(4-methoxyphenyl)-8-(3-methyl-2-buten-1-yl)-; Anhydroicaritin |
| PubChem | 5318980 |
| ChEMBL | CHEMBL498485 |
| ChemSpider | 4477409 |
| ChemIDPlus | 118525409 |