Systematic / IUPAC Name: 2-(4,5-Dihydroxy-2-methylphenyl)-6-hydroxy-4-methoxybenzoic acid
ID: Reference7638
Other Names:
Alutenusin;
[1,1'-Biphenyl]-2-carboxylic acid, 3,4',5'-trihydroxy-5-methoxy-2'-methyl-;
2-(4,5-Dihydroxy-2-methyl-phenyl)-6-hydroxy-4-methoxy-benzoic acid;
3,4',5'-Trihydroxy-5-methoxy-2'-methyl-[1,1'-biphenyl]-2-carboxylic acid
Formula: C15H14O6
3,4',5'-Trihydroxy-5-methoxy-2'-methyl-2-biphenylcarboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/26/2018 1:33:43 PM |
| InChI | InChI=1S/C15H14O6/c1-7-3-11(16)12(17)6-9(7)10-4-8(21-2)5-13(18)14(10)15(19)20/h3-6,16-18H,1-2H3,(H,19,20) |
| InChI Key | ADPBTBPPIIKLEH-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=C(C=C1C2=CC(=CC(=C2C(=O)O)O)OC)O)O |
| CAS | 31186126 |
| Splash | |
| Other Names |
Alutenusin; [1,1'-Biphenyl]-2-carboxylic acid, 3,4',5'-trihydroxy-5-methoxy-2'-methyl-; 2-(4,5-Dihydroxy-2-methyl-phenyl)-6-hydroxy-4-methoxy-benzoic acid; 3,4',5'-Trihydroxy-5-methoxy-2'-methyl-[1,1'-biphenyl]-2-carboxylic acid |
| ChemSpider | 5293666 |
| PubChem | 6918469 |
| ChEMBL | CHEMBL483531 |