Systematic / IUPAC Name: 3-Methoxy-4-(3-methyl-2-buten-1-yl)-5-[(E)-2-phenylvinyl]phenol
ID: Reference7667
Other Names:
Longistylin C;
Longistyline C;
Phenol, 3-methoxy-4-(3-methyl-2-butenyl)-5-(2-phenylethenyl)-, (E)-
Formula: C20H22O2
3-Methoxy-4-(3-methyl-2-buten-1-yl)-5-[(E)-2-phenylvinyl]phenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/29/2018 11:44:35 AM |
| InChI | InChI=1S/C20H22O2/c1-15(2)9-12-19-17(13-18(21)14-20(19)22-3)11-10-16-7-5-4-6-8-16/h4-11,13-14,21H,12H2,1-3H3/b11-10+ |
| InChI Key | NFAWEPOBHKEHPO-ZHACJKMWSA-N |
| Canonical SMILES | CC(=CCC1=C(C=C(C=C1C=CC2=CC=CC=C2)O)OC)C |
| CAS | |
| Splash | |
| Other Names |
Longistylin C; Longistyline C; Phenol, 3-methoxy-4-(3-methyl-2-butenyl)-5-(2-phenylethenyl)-, (E)- |
| ChemIDPlus | 064125606 |
| ChEMBL | CHEMBL445702 |
| PubChem | 6446720 |
| ChemSpider | 4950242 |