Systematic / IUPAC Name: (2R,3S)-2-(3,4-Dihydroxybenzyl)-2-hydroxy-3-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)-2-propenoyl]oxy}succinic acid
ID: Reference7679
Other Names:
Butanedioic acid, 2-[(3,4-dihydroxyphenyl)methyl]-2-hydroxy-3-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propenyl]oxy}-, (2R,3S)- ;
Butanedioic acid, 2-[(3,4-dihydroxyphenyl)methyl]-2-hydroxy-3-{[3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propenyl]oxy}-, (S-(R*,S*(E)))-
Formula: C21H20O11
Cimicifugic acid A mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/3/2018 11:15:19 AM |
| InChI | InChI=1S/C21H20O11/c1-31-16-9-11(2-6-14(16)23)4-7-17(25)32-18(19(26)27)21(30,20(28)29)10-12-3-5-13(22)15(24)8-12/h2-9,18,22-24,30H,10H2,1H3,(H,26,27)(H,28,29)/b7-4+/t18-,21-/m1/s1 |
| InChI Key | LIJMMUDJSMCVDJ-ZHBFVYIWSA-N |
| Canonical SMILES | COC1=C(C=CC(=C1)C=CC(=O)OC(C(=O)O)C(CC2=CC(=C(C=C2)O)O)(C(=O)O)O)O |
| CAS | |
| Splash | |
| Other Names |
Butanedioic acid, 2-[(3,4-dihydroxyphenyl)methyl]-2-hydroxy-3-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propenyl]oxy}-, (2R,3S)- ; Butanedioic acid, 2-[(3,4-dihydroxyphenyl)methyl]-2-hydroxy-3-{[3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propenyl]oxy}-, (S-(R*,S*(E)))- |
| PubChem | 6449879 |
| ChemIDPlus | 205114654 |
| ChemSpider | 4952552 |
| ChEMBL | CHEMBL517537 |