Systematic / IUPAC Name: 7-Chloro-4,6-dimethoxy-3a,12a-dihydro-5H-furo[3',2':4,5]furo[3,2-b]xanthen-5-one
ID: Reference7692
Other Names:
Austocystin A;
5H-Furo[3',2':4,5]furo[3,2-b]xanthen-5-one, 7-chloro-3a,12a-dihydro-4,6-dimethoxy-
Formula: C19H13ClO6
7-Chloro-4,6-dimethoxy-3a,12a-dihydro-5H-furo[3',2':4,5]furo[3,2-b]xanthen-5-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/4/2018 10:08:26 AM |
| InChI | InChI=1S/C19H13ClO6/c1-22-17-9(20)3-4-10-14(17)16(21)15-12(25-10)7-11-13(18(15)23-2)8-5-6-24-19(8)26-11/h3-8,19H,1-2H3 |
| InChI Key | POXKBPUNCDMQMW-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C(C=CC2=C1C(=O)C3=C(C4=C(C=C3O2)OC5C4C=CO5)OC)Cl |
| CAS | |
| Splash | |
| Other Names |
Austocystin A; 5H-Furo[3',2':4,5]furo[3,2-b]xanthen-5-one, 7-chloro-3a,12a-dihydro-4,6-dimethoxy- |