Systematic / IUPAC Name: 2'-O-Acetyl-3'-O-(4-hydroxy-2-methoxy-6-methylbenzoyl)uridine
ID: Reference7693
Other Names: Uridine, 2'-acetate 3'-(4-hydroxy-2-methoxy-6-methylbenzoate)
Formula: C20H22N2O10
2'-O-Acetyl-3'-O-(4-hydroxy-2-methoxy-6-methylbenzoyl)uridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/4/2018 10:52:31 AM |
| InChI | InChI=1S/C20H22N2O10/c1-9-6-11(25)7-12(29-3)15(9)19(27)32-16-13(8-23)31-18(17(16)30-10(2)24)22-5-4-14(26)21-20(22)28/h4-7,13,16-18,23,25H,8H2,1-3H3,(H,21,26,28)/t13-,16-,17-,18-/m1/s1 |
| InChI Key | ULPUBSPPYRXUOZ-BNEJOLLZSA-N |
| Canonical SMILES | CC1=CC(=CC(=C1C(=O)OC2C(OC(C2OC(=O)C)N3C=CC(=O)NC3=O)CO)OC)O |
| CAS | |
| Splash | |
| Other Names | Uridine, 2'-acetate 3'-(4-hydroxy-2-methoxy-6-methylbenzoate) |