Systematic / IUPAC Name: 4-Hydroxy-2',6-dimethoxy-6'-methyl-3H,4'H-spiro[1-benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione
ID: Reference7695
Other Names: Spiro[benzofuran-2(3H),1'-cyclohex[2]ene]-3,4'-dione, 4-hydroxy-2',6-dimethoxy-6'-methyl-
Formula: C16H16O6
4-Hydroxy-2',6-dimethoxy-6'-methyl-3H,4'H-spiro[1-benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/4/2018 12:27:45 PM |
| InChI | InChI=1S/C16H16O6/c1-8-4-9(17)5-13(21-3)16(8)15(19)14-11(18)6-10(20-2)7-12(14)22-16/h5-8,18H,4H2,1-3H3 |
| InChI Key | RFVMVHYMAGKNDK-UHFFFAOYSA-N |
| Canonical SMILES | CC1CC(=O)C=C(C12C(=O)C3=C(C=C(C=C3O2)OC)O)OC |
| CAS | |
| Splash | |
| Other Names | Spiro[benzofuran-2(3H),1'-cyclohex[2]ene]-3,4'-dione, 4-hydroxy-2',6-dimethoxy-6'-methyl- |