Systematic / IUPAC Name: (2S,3S,4aS)-2,3,7-Trihydroxy-9-methoxy-4a-methyl-2,3,4,4a-tetrahydro-6H-benzo[c]chromen-6-one
ID: Reference7709
Other Names: (2S,3S,4aS)-2,3,7-Trihydroxy-9-methoxy-4a-methyl-2H,3H,4H,4aH,6H-benzo[c]chromen-6-one
Formula: C15H16O6
Altenuene mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/5/2018 11:22:02 AM |
| InChI | InChI=1S/C15H16O6/c1-15-6-12(18)10(16)5-9(15)8-3-7(20-2)4-11(17)13(8)14(19)21-15/h3-5,10,12,16-18H,6H2,1-2H3/t10-,12-,15-/m0/s1 |
| InChI Key | MMHTXEATDNFMMY-WBIUFABUSA-N |
| Canonical SMILES | CC12CC(C(C=C1C3=CC(=CC(=C3C(=O)O2)O)OC)O)O |
| CAS | |
| Splash | |
| Other Names | (2S,3S,4aS)-2,3,7-Trihydroxy-9-methoxy-4a-methyl-2H,3H,4H,4aH,6H-benzo[c]chromen-6-one |
| PubChem | 34687 |
| ChEMBL | CHEMBL482228 |
| ChemSpider | 31922 |
| ChemIDPlus | 029752430 |