Systematic / IUPAC Name: α-D-Glucopyranosyl 3-O-(2-methylbutanoyl)-α-D-glucopyranoside
ID: Reference7710
Other Names: α-D-Glucopyranoside, α-D-glucopyranosyl, 3-(2-methylbutanoate)
Formula: C17H30O12
α-D-Glucopyranosyl 3-O-(2-methylbutanoyl)-α-D-glucopyranoside mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 112 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/5/2018 11:13:19 AM |
| InChI | InChI=1S/C17H30O12/c1-3-6(2)15(25)28-14-10(21)8(5-19)27-17(13(14)24)29-16-12(23)11(22)9(20)7(4-18)26-16/h6-14,16-24H,3-5H2,1-2H3/t6?,7-,8-,9-,10-,11+,12-,13-,14+,16-,17-/m1/s1 |
| InChI Key | SFAOCCXTEHOWEV-AGJOLMTFSA-N |
| Canonical SMILES | CCC(C)C(=O)OC1C(C(OC(C1O)OC2C(C(C(C(O2)CO)O)O)O)CO)O |
| CAS | |
| Splash | |
| Other Names | α-D-Glucopyranoside, α-D-glucopyranosyl, 3-(2-methylbutanoate) |