Systematic / IUPAC Name: DL-Valine
ID: Reference772
Other Names:
(RS)-Valine;
(S)-2-Amino-3-methylbutanoic acid;
Butanoic acid, 2-amino-3-methyl-;
D,L-Valine;
DL-Val
; more
Formula: C5H11NO2
Class: Endogenous Metabolites
Valine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 225 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 4/21/2022 2:22:26 PM |
| InChI | InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8) |
| InChI Key | KZSNJWFQEVHDMF-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)C(C(=O)O)N |
| CAS | 72184 |
| Splash | |
| Other Names |
(RS)-Valine; (S)-2-Amino-3-methylbutanoic acid; Butanoic acid, 2-amino-3-methyl-; D,L-Valine; DL-Val; H-DL-Val-OH; Valin; Valina; Valine, DL-; (+/-)-α-Aminoisovaleric acid; 2-Amino-3-methylbutanoic acid; 2-Amino-3-methylbutanoic acid (DL-valine); 2-Amino-3-methylbutanoic acid, DL-; 2-Amino-3-methylbutyric acid, DL-; 2-Aminoisovaleric acid; 2-Aminoisovaleric acid, DL-; DL-α-Aminoisovaleric acid; DL-2-Amino-3-methylbutanoic acid; DL-2-Aminoisovaleric acid |
| KEGG | C16436 |
| ChemSpider | 1148 |
| ChemIDPlus | 000516063 |
| WebBook | 1356348862 |
| ChEMBL | CHEMBL11257 |
| ChEBI | CHEBI:27266 |
| Wikipedia | Valine |
| PubChem | 1182 |