Systematic / IUPAC Name: (1α,2β)-2,9,10-Trimethoxy-3,12-didehydrogalanthan-1-ol
ID: Reference7741
Other Names:
Galanthin;
Galanthan-1-ol, 3,12-didehydro-2,9,10-trimethoxy-, (1α,2β)-;
1H-Pyrrolo[3,2,1-de]phenanthridin-1-ol, 2,4,5,7,11b,11c-hexahydro-2,9,10-trimethoxy-, (1S,2S,11bS,11cS)-
Formula: C18H23NO4
Galanthine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/10/2018 9:44:59 AM |
| InChI | InChI=1S/C18H23NO4/c1-21-13-7-11-9-19-5-4-10-6-15(23-3)18(20)16(17(10)19)12(11)8-14(13)22-2/h6-8,15-18,20H,4-5,9H2,1-3H3/t15-,16-,17+,18+/m0/s1 |
| InChI Key | VOIMPDXOQJYVDI-WNRNVDISSA-N |
| Canonical SMILES | COC1C=C2CCN3C2C(C1O)C4=CC(=C(C=C4C3)OC)OC |
| CAS | |
| Splash | |
| Other Names |
Galanthin; Galanthan-1-ol, 3,12-didehydro-2,9,10-trimethoxy-, (1α,2β)-; 1H-Pyrrolo[3,2,1-de]phenanthridin-1-ol, 2,4,5,7,11b,11c-hexahydro-2,9,10-trimethoxy-, (1S,2S,11bS,11cS)- |
| PubChem | 10403528 |
| ChEMBL | CHEMBL1172893 |
| ChemSpider | 8578966 |