Systematic / IUPAC Name: 7-Hydroxy-3-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-8-(3-methylbut-2-enyl)chromen-4-one
ID: Reference7756
Other Names:
Erysubin F;
4H-1-Benzopyran-4-one, 7-hydroxy-3-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-8-(3-methyl-2-buten-1-yl)-
Formula: C25H26O4
7-Hydroxy-3-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/11/2018 11:52:20 AM |
| InChI | InChI=1S/C25H26O4/c1-15(2)5-7-18-13-17(8-11-22(18)26)21-14-29-25-19(9-6-16(3)4)23(27)12-10-20(25)24(21)28/h5-6,8,10-14,26-27H,7,9H2,1-4H3 |
| InChI Key | YBJJPNXZVZRDIU-UHFFFAOYSA-N |
| Canonical SMILES | CC(=CCC1=C(C=CC(=C1)C2=COC3=C(C2=O)C=CC(=C3CC=C(C)C)O)O)C |
| CAS | |
| Splash | |
| Other Names |
Erysubin F; 4H-1-Benzopyran-4-one, 7-hydroxy-3-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-8-(3-methyl-2-buten-1-yl)- |
| ChemSpider | 28669808 |
| PubChem | 12051847 |
| ChEMBL | CHEMBL2159045 |