Systematic / IUPAC Name: Methyl 3,5-dimethoxy-2-({5-methoxy-4-oxo-6-[(1E)-1-propen-1-yl]-4H-pyran-3-yl}carbonyl)benzoate
ID: Reference7775
Other Names: Benzoic acid, 3,5-dimethoxy-2-({5-methoxy-4-oxo-6-[(1E)-1-propen-1-yl]-4H-pyran-3-yl}carbonyl)-, methyl ester
Formula: C20H20O8
3-O-Methylfunicone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/13/2018 12:53:45 PM |
| InChI | InChI=1S/C20H20O8/c1-6-7-14-19(26-4)18(22)13(10-28-14)17(21)16-12(20(23)27-5)8-11(24-2)9-15(16)25-3/h6-10H,1-5H3/b7-6+ |
| InChI Key | WGLRJONCGNNMKL-VOTSOKGWSA-N |
| Canonical SMILES | CC=CC1=C(C(=O)C(=CO1)C(=O)C2=C(C=C(C=C2C(=O)OC)OC)OC)OC |
| CAS | |
| Splash | |
| Other Names | Benzoic acid, 3,5-dimethoxy-2-({5-methoxy-4-oxo-6-[(1E)-1-propen-1-yl]-4H-pyran-3-yl}carbonyl)-, methyl ester |
| ChemSpider | 8723692 |
| ChEMBL | CHEMBL3593571 |
| Wikipedia | 3-O-Methylfunicone |
| PubChem | 10548301 |