Systematic / IUPAC Name: 5-Hydroxy-2-(2-hydroxy-6-methoxyphenyl)-6,7,8-trimethoxy-4H-chromen-4-one
ID: Reference7780
Other Names:
Neobaicalein;
Scullcapflavone II;
Skullcapflavone II;
4H-1-Benzopyran-4-one, 5-hydroxy-2-(2-hydroxy-6-methoxyphenyl)-6,7,8-trimethoxy-;
5-Hydroxy-2-(2-hydroxy-6-methoxyphenyl)-6,7,8-trimethoxy-4H-1-benzopyran-4-one
Formula: C19H18O8
5,2'-Dihydroxy-6,7,8,6'-tetramethoxyflavone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/16/2018 9:07:06 AM |
| InChI | InChI=1S/C19H18O8/c1-23-11-7-5-6-9(20)13(11)12-8-10(21)14-15(22)17(24-2)19(26-4)18(25-3)16(14)27-12/h5-8,20,22H,1-4H3 |
| InChI Key | GMQFOKBGMKVUQZ-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=CC(=C1C2=CC(=O)C3=C(O2)C(=C(C(=C3O)OC)OC)OC)O |
| CAS | 55084087 |
| Splash | |
| Other Names |
Neobaicalein; Scullcapflavone II; Skullcapflavone II; 4H-1-Benzopyran-4-one, 5-hydroxy-2-(2-hydroxy-6-methoxyphenyl)-6,7,8-trimethoxy-; 5-Hydroxy-2-(2-hydroxy-6-methoxyphenyl)-6,7,8-trimethoxy-4H-1-benzopyran-4-one; 5-Hydroxy-2-(2-hydroxy-6-methoxy-phenyl)-6,7,8-trimethoxy-chromen-4-one |
| ChemSpider | 110666 |
| ChemIDPlus | 055084087 |
| ChEBI | CHEBI:9061 |
| ChEMBL | CHEMBL465561 |
| PubChem | 124211 |
| KEGG | C10183 |