Systematic / IUPAC Name: (1R,4aS)-7-(2-Hydroxypropan-2-yl)-1,4a-dimethyl-9-oxo-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid
ID: Reference7786
Other Names: 15-Hydroxy-7-oxoabieta-8,11,13-trien-18-oic acid
Formula: C20H26O4
(1R,4aS)-7-(2-Hydroxypropan-2-yl)-1,4a-dimethyl-9-oxo-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/16/2018 12:07:19 PM |
| InChI | InChI=1S/C20H26O4/c1-18(2,24)12-6-7-14-13(10-12)15(21)11-16-19(14,3)8-5-9-20(16,4)17(22)23/h6-7,10,16,24H,5,8-9,11H2,1-4H3,(H,22,23)/t16?,19-,20-/m1/s1 |
| InChI Key | MXPXAZNVQUWDFH-ODFWGIBRSA-N |
| Canonical SMILES | CC12CCCC(C1CC(=O)C3=C2C=CC(=C3)C(C)(C)O)(C)C(=O)O |
| CAS | |
| Splash | |
| Other Names | 15-Hydroxy-7-oxoabieta-8,11,13-trien-18-oic acid |
| PubChem | 72550682 |