Systematic / IUPAC Name: (3S)-5-[(1R,2R,4aS,8aS)-2-Hydroxy-2,5,5,8a-tetramethyldecahydro-1-naphthalenyl]-3-methylpentanoic acid
ID: Reference7789
Other Names: 1-Naphthalenepentanoic acid, decahydro-2-hydroxy-β,2,5,5,8a-pentamethyl-, (βS,1R,2R,4aS,8aS)-
Formula: C20H36O3
Labdanolic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/16/2018 1:19:52 PM |
| InChI | InChI=1S/C20H36O3/c1-14(13-17(21)22)7-8-16-19(4)11-6-10-18(2,3)15(19)9-12-20(16,5)23/h14-16,23H,6-13H2,1-5H3,(H,21,22)/t14-,15-,16+,19-,20+/m0/s1 |
| InChI Key | KHCCSRVJJDOANA-RQOBALISSA-N |
| Canonical SMILES | CC(CCC1C2(CCCC(C2CCC1(C)O)(C)C)C)CC(=O)O |
| CAS | |
| Splash | |
| Other Names | 1-Naphthalenepentanoic acid, decahydro-2-hydroxy-β,2,5,5,8a-pentamethyl-, (βS,1R,2R,4aS,8aS)- |
| PubChem | 11186394 |
| ChEMBL | CHEMBL1172637 |
| ChemSpider | 9361478 |