Systematic / IUPAC Name: N-[[(2R,3S,4R)-3-Hydroxy-4-[(4-methoxyphenyl)methylamino]oxolan-2-yl]methyl]thiophene-2-carboxamide
ID: Reference7790
Other Names:
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[[(4-methoxyphenyl)methyl]amino]-5-[(2-thienylcarbonyl)amino]-;
NAT19-551320
Formula: C18H22N2O4S
1,4-Anhydro-2,5-dideoxy-2-[(4-methoxybenzyl)amino]-5-[(2-thienylcarbonyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 295 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/25/2022 7:39:24 AM |
| InChI | InChI=1S/C18H22N2O4S/c1-23-13-6-4-12(5-7-13)9-19-14-11-24-15(17(14)21)10-20-18(22)16-3-2-8-25-16/h2-8,14-15,17,19,21H,9-11H2,1H3,(H,20,22)/t14-,15-,17+/m1/s1 |
| InChI Key | PVMORAWBOCWSRO-INMHGKMJSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)CNC2COC(C2O)CNC(=O)C3=CC=CS3 |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[[(4-methoxyphenyl)methyl]amino]-5-[(2-thienylcarbonyl)amino]-; NAT19-551320 |