Systematic / IUPAC Name: 3-(1-Carboxyethenoxy)benzoic acid
ID: Reference7821
Other Names:
3-[(1-Carboxyethenyl)oxy]benzoic acid;
Benzoic acid, 3-[(1-carboxyethenyl)oxy]-
Formula: C10H8O5
3-[(1-Carboxyvinyl)oxy]benzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 662 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/20/2018 8:44:23 AM |
| InChI | InChI=1S/C10H8O5/c1-6(9(11)12)15-8-4-2-3-7(5-8)10(13)14/h2-5H,1H2,(H,11,12)(H,13,14) |
| InChI Key | HGVAHYJMDVROLE-UHFFFAOYSA-N |
| Canonical SMILES | C=C(C(=O)O)OC1=CC=CC(=C1)C(=O)O |
| CAS | 16929376 |
| Splash | |
| Other Names |
3-[(1-Carboxyethenyl)oxy]benzoic acid; Benzoic acid, 3-[(1-carboxyethenyl)oxy]- |
| PubChem | 23844017 |
| ChEBI | CHEBI:77107 |
| ChemSpider | 22369661 |