Systematic / IUPAC Name: [7-(3,4-Dihydroxyphenyl)-1-(4-hydroxyphenyl)heptan-3-yl] acetate
ID: Reference7827
Other Names: 1,2-Benzenediol, 4-[5-(acetyloxy)-7-(4-hydroxyphenyl)heptyl]-
Formula: C21H26O5
7-(3,4-Dihydroxyphenyl)-1-(4-hydroxyphenyl)-3-heptanyl acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1745 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/20/2018 1:27:22 PM |
| InChI | InChI=1S/C21H26O5/c1-15(22)26-19(12-8-16-6-10-18(23)11-7-16)5-3-2-4-17-9-13-20(24)21(25)14-17/h6-7,9-11,13-14,19,23-25H,2-5,8,12H2,1H3 |
| InChI Key | HLPXMGYELYMAQM-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)OC(CCCCC1=CC(=C(C=C1)O)O)CCC2=CC=C(C=C2)O |
| CAS | |
| Splash | |
| Other Names | 1,2-Benzenediol, 4-[5-(acetyloxy)-7-(4-hydroxyphenyl)heptyl]- |