Systematic / IUPAC Name: (4aS)-6,7-Dihydroxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one
ID: Reference7832
Other Names:
Nimbidiol ;
9(1H)-Phenanthrenone, 2,3,4,4a,10,10a-hexahydro-6,7-dihydroxy-1,1,4a-trimethyl-, (4aS)-
Formula: C17H22O3
(5ξ)-12,13-Dihydroxypodocarpa-8,11,13-trien-7-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/23/2018 7:09:10 AM |
| InChI | InChI=1S/C17H22O3/c1-16(2)5-4-6-17(3)11-8-14(20)13(19)7-10(11)12(18)9-15(16)17/h7-8,15,19-20H,4-6,9H2,1-3H3/t15?,17-/m1/s1 |
| InChI Key | JMBKXUYCBVKSSY-OMOCHNIRSA-N |
| Canonical SMILES | CC1(CCCC2(C1CC(=O)C3=CC(=C(C=C32)O)O)C)C |
| CAS | |
| Splash | |
| Other Names |
Nimbidiol ; 9(1H)-Phenanthrenone, 2,3,4,4a,10,10a-hexahydro-6,7-dihydroxy-1,1,4a-trimethyl-, (4aS)- |