Systematic / IUPAC Name: (5S,10Z,11aR)-5-Acetoxy-6,10-bis(hydroxymethyl)-3-methylene-2-oxo-2,3,3a,4,5,8,9,11a-octahydrocyclodeca[b]furan-4-yl 2-methylbutanoate
ID: Reference7838
Other Names: Butanoic acid, 2-methyl-, (5S,10Z,11aR)-5-(acetyloxy)-2,3,3a,4,5,8,9,11a-octahydro-6,10-bis(hydroxymethyl)-3-methylene-2-oxocyclodeca[b]furan-4-yl ester
Formula: C22H30O8
(5S,10Z,11aR)-5-Acetoxy-6,10-bis(hydroxymethyl)-3-methylene-2-oxo-2,3,3a,4,5,8,9,11a-octahydrocyclodeca[b]furan-4-yl 2-methylbutanoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1917 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/23/2018 11:46:41 AM |
| InChI | InChI=1S/C22H30O8/c1-5-12(2)21(26)30-20-18-13(3)22(27)29-17(18)9-15(10-23)7-6-8-16(11-24)19(20)28-14(4)25/h8-9,12,17-20,23-24H,3,5-7,10-11H2,1-2,4H3/b15-9-,16-8-/t12?,17-,18?,19+,20?/m1/s1 |
| InChI Key | LQQVURUBFJKELJ-BNFMWDMMSA-N |
| Canonical SMILES | CCC(C)C(=O)OC1[C@H](/C(=C/CC/C(=C/[C@@H]2C1C(=C)C(=O)O2)/CO)/CO)OC(=O)C |
| CAS | |
| Splash | |
| Other Names | Butanoic acid, 2-methyl-, (5S,10Z,11aR)-5-(acetyloxy)-2,3,3a,4,5,8,9,11a-octahydro-6,10-bis(hydroxymethyl)-3-methylene-2-oxocyclodeca[b]furan-4-yl ester |
| ChemSpider | 29814146 |