Systematic / IUPAC Name: [(1S,5R,6S)-5-Acetyloxy-3-(hydroxymethyl)-4-oxo-6-propan-2-ylcyclohex-2-en-1-yl] (E)-2-methylbut-2-enoate
ID: Reference7841
Other Names: 2-Butenoic acid, 2-methyl-, (1S,5R,6S)-5-(acetyloxy)-3-(hydroxymethyl)-6-(1-methylethyl)-4-oxo-2-cyclohexen-1-yl ester, (2E)-
Formula: C17H24O6
(1S,5R,6S)-5-Acetoxy-3-(hydroxymethyl)-6-isopropyl-4-oxo-2-cyclohexen-1-yl (2E)-2-methyl-2-butenoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/23/2018 12:29:02 PM |
| InChI | InChI=1S/C17H24O6/c1-6-10(4)17(21)23-13-7-12(8-18)15(20)16(22-11(5)19)14(13)9(2)3/h6-7,9,13-14,16,18H,8H2,1-5H3/b10-6+/t13-,14-,16+/m0/s1 |
| InChI Key | RCCXCTSYJHNSRE-KOPIJTNESA-N |
| Canonical SMILES | CC=C(C)C(=O)OC1C=C(C(=O)C(C1C(C)C)OC(=O)C)CO |
| CAS | |
| Splash | |
| Other Names | 2-Butenoic acid, 2-methyl-, (1S,5R,6S)-5-(acetyloxy)-3-(hydroxymethyl)-6-(1-methylethyl)-4-oxo-2-cyclohexen-1-yl ester, (2E)- |