Systematic / IUPAC Name: (3α,16α)-14,15-Dihydroeburnamenin-14-one
ID: Reference7846
Other Names:
(-)-Eburnamonine;
(-)-Vincamone;
(3α,16α)-Eburnamenin-14(15H)-one;
cis-Vincamone;
16-Oxoeburnane
; more
Formula: C19H22N2O
Vinburnine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/24/2018 7:02:28 AM |
| InChI | InChI=1S/C19H22N2O/c1-2-19-9-5-10-20-11-8-14-13-6-3-4-7-15(13)21(16(22)12-19)17(14)18(19)20/h3-4,6-7,18H,2,5,8-12H2,1H3/t18-,19+/m1/s1 |
| InChI Key | WYJAPUKIYAZSEM-MOPGFXCFSA-N |
| Canonical SMILES | CCC12CCCN3C1C4=C(CC3)C5=CC=CC=C5N4C(=O)C2 |
| CAS | |
| Splash | |
| Other Names |
(-)-Eburnamonine; (-)-Vincamone; (3α,16α)-Eburnamenin-14(15H)-one; cis-Vincamone; 16-Oxoeburnane; 3α,16α-Eburnamonine; Eburnal; Eburnal ritardo; Eburnamonine; Eburnamonine (-); L-Eburnamonine; Vincamone |
| ChEMBL | CHEMBL1892145 |
| KEGG | C09149; D08676 |
| ChemSpider | 64339 |
| PubChem | 71203 |
| ChemIDPlus | 004880880 |
| ChEBI | CHEBI:4740 |
| Wikipedia | Vincamone |