Systematic / IUPAC Name: (8β)-N,N-Diethyl-6-methyl-9,10-didehydroergoline-8-carboxamide
ID: Reference786
Other Names:
Lysergic acid diethylamide;
N,N-Diethyllysergamide;
Lysergamide, N-,N-diethyl-;
(+)-Lysergic acid diethylamide;
Ergoline-8-carboxamide, 9,10-didehydro-N-,N-diethyl-6-methyl, (8β)-
; more
Formula: C20H25N3O
Class: Drugs of Abuse/Illegal Drugs
Lysergic acid diethylamide (LSD) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 200 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/9/2015 3:49:15 PM |
| InChI | InChI=1S/C20H25N3O/c1-4-23(5-2)20(24)14-9-16-15-7-6-8-17-19(15)13(11-21-17)10-18(16)22(3)12-14/h6-9,11,14,18,21H,4-5,10,12H2,1-3H3/t14-,18-/m1/s1 |
| InChI Key | VAYOSLLFUXYJDT-RDTXWAMCSA-N |
| Canonical SMILES | |
| CAS | 50373 |
| Splash | |
| Other Names |
Lysergic acid diethylamide; N,N-Diethyllysergamide; Lysergamide, N-,N-diethyl-; (+)-Lysergic acid diethylamide; Ergoline-8-carboxamide, 9,10-didehydro-N-,N-diethyl-6-methyl, (8β)-; (8β)-N,N-Diethyl-6-methyl-9,10-didehydroergoline-8-carboxamide; (8R)-9,10-Didehydro-N-,N-diethyl-6-methylergoline-8-carboxamide; Lysergide; Lysergamid; Delysid; LSD; Blue mist; Blue star |
| ChemSpider | 3843 |
| KEGG | C07542 |
| ChEMBL | CHEMBL263881 |
| ChemIDPlus | 000050373; 015232630; 024656415; 032426576 |
| ChEBI | CHEBI:6605 |
| Wikipedia | LSD |
| PubChem | 5761 |