Systematic / IUPAC Name: 4-[5-(3,4-Dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]phenol
ID: Reference7873
Other Names: Phenol, 4-[5-(3,4-dimethoxyphenyl)tetrahydro-3,4-dimethyl-2-furanyl]-
Formula: C20H24O4
4-[5-(3,4-Dimethoxyphenyl)-3,4-dimethyltetrahydro-2-furanyl]phenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/1/2018 11:43:29 AM |
| InChI | InChI=1S/C20H24O4/c1-12-13(2)20(15-7-10-17(22-3)18(11-15)23-4)24-19(12)14-5-8-16(21)9-6-14/h5-13,19-21H,1-4H3 |
| InChI Key | XCRBJSLPMIXFOO-UHFFFAOYSA-N |
| Canonical SMILES | CC1C(C(OC1C2=CC=C(C=C2)O)C3=CC(=C(C=C3)OC)OC)C |
| CAS | |
| Splash | |
| Other Names | Phenol, 4-[5-(3,4-dimethoxyphenyl)tetrahydro-3,4-dimethyl-2-furanyl]- |