Systematic / IUPAC Name: 2,4,6-Trihydroxy-2-[(4-hydroxyphenyl)methyl]-1-benzofuran-3-one
ID: Reference7874
Other Names:
Maesopsin;
3(2H)-Benzofuranone, 2,4,6-trihydroxy-2-[(4-hydroxyphenyl)methyl]-
Formula: C15H12O6
2,4,6-Trihydroxy-2-(4-hydroxybenzyl)-1-benzofuran-3(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1306 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/1/2018 12:42:51 PM |
| InChI | InChI=1S/C15H12O6/c16-9-3-1-8(2-4-9)7-15(20)14(19)13-11(18)5-10(17)6-12(13)21-15/h1-6,16-18,20H,7H2 |
| InChI Key | LOFYFDPXORJJEE-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1CC2(C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
| CAS | 5989162 |
| Splash | |
| Other Names |
Maesopsin; 3(2H)-Benzofuranone, 2,4,6-trihydroxy-2-[(4-hydroxyphenyl)methyl]- |
| ChEMBL | CHEMBL462109 |
| ChemIDPlus | 005989162; 5989162 |
| ChemSpider | 141288 |
| PubChem | 160803 |