Systematic / IUPAC Name: 3a-(3,4-Dimethoxyphenyl)-1-methyl-2,3,4,5-tetrahydroindol-6-one
ID: Reference7875
Other Names: 6H-Indol-6-one, 3a-(3,4-dimethoxyphenyl)-1,2,3,3a,4,5-hexahydro-1-methyl-
Formula: C17H21NO3
3a-(3,4-Dimethoxyphenyl)-1-methyl-1,2,3,3a,4,5-hexahydro-6H-indol-6-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/1/2018 12:40:21 PM |
| InChI | InChI=1S/C17H21NO3/c1-18-9-8-17(7-6-13(19)11-16(17)18)12-4-5-14(20-2)15(10-12)21-3/h4-5,10-11H,6-9H2,1-3H3 |
| InChI Key | XPUOZJJNPJXFTD-UHFFFAOYSA-N |
| Canonical SMILES | CN1CCC2(C1=CC(=O)CC2)C3=CC(=C(C=C3)OC)OC |
| CAS | |
| Splash | |
| Other Names | 6H-Indol-6-one, 3a-(3,4-dimethoxyphenyl)-1,2,3,3a,4,5-hexahydro-1-methyl- |