Systematic / IUPAC Name: (1S,3R,4R,5R)-3,4-Bis{[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoyl]oxy}-1,5-dihydroxycyclohexanecarboxylic acid
ID: Reference7879
Other Names:
3,4-Di-O-Caffeoylquinic acid;
3,4-Dicaffeoylquinic acid;
Isochlorogenic-acid-B;
Quinic acid 3,4-di-O-caffeate;
(1S,3R,4R,5R)-3,4-Bis({[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy})-1,5-dihydroxycyclohexane-1-carboxylic acid
Formula: C25H24O12
4,5-Dicaffeoylquinic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 3 |
| No. of Spectra | 4997 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/2/2018 7:59:54 AM |
| InChI | InChI=1S/C25H24O12/c26-15-5-1-13(9-17(15)28)3-7-21(31)36-20-12-25(35,24(33)34)11-19(30)23(20)37-22(32)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-30,35H,11-12H2,(H,33,34)/b7-3+,8-4+/t19-,20-,23-,25+/m1/s1 |
| InChI Key | UFCLZKMFXSILNL-PSEXTPKNSA-N |
| Canonical SMILES | C1C(C(C(CC1(C(=O)O)O)OC(=O)C=CC2=CC(=C(C=C2)O)O)OC(=O)C=CC3=CC(=C(C=C3)O)O)O |
| CAS | 14534613 |
| Splash | |
| Other Names |
3,4-Di-O-Caffeoylquinic acid; 3,4-Dicaffeoylquinic acid; Isochlorogenic-acid-B; Quinic acid 3,4-di-O-caffeate; (1S,3R,4R,5R)-3,4-Bis({[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy})-1,5-dihydroxycyclohexane-1-carboxylic acid; Cyclohexanecarboxylic acid, 3,4-bis{[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy}-1,5-dihydroxy, (1S,3R,4R,5R)- |
| ChEBI | CHEBI:5995 |
| ChEMBL | CHEMBL249448 |
| ChemIDPlus | 014534613 |
| PubChem | 5281780 |
| KEGG | C10468 |
| ChemSpider | 4445093 |
| HMDb | HMDB30705 |