Systematic / IUPAC Name: 4,8-Dihydroxy-quinoline-2-carboxylic acid
ID: Reference789
Other Names:
8-Hydroxykynurenic acid;
4,8-Dihydroxyquinaldic acid;
Quinaldic acid, 4,8-dihydroxy-;
8-Hydroxykynurenate;
Quinoline-2-carboxylic acid, 4,8-dihydroxy-
; more
Formula: C10H7NO4
Class: Endogenous Metabolites
Xanthurenic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 5 |
| No. of Spectra | 1163 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 10/12/2016 11:45:17 AM |
| InChI | InChI=1S/C10H7NO4/c12-7-3-1-2-5-8(13)4-6(10(14)15)11-9(5)7/h1-4,12H,(H,11,13)(H,14,15) |
| InChI Key | FBZONXHGGPHHIY-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC2=C(C(=C1)O)NC(=CC2=O)C(=O)O |
| CAS | 59007 |
| Splash | |
| Other Names |
8-Hydroxykynurenic acid; 4,8-Dihydroxyquinaldic acid; Quinaldic acid, 4,8-dihydroxy-; 8-Hydroxykynurenate; Quinoline-2-carboxylic acid, 4,8-dihydroxy-; 8-Hydroxy-4-oxo-1,4-dihydroquinoline-2-carboxylic acid; Xanthurate |
| ChemIDPlus | 000059007 |
| ChEMBL | CHEMBL312535 |
| ChEBI | CHEBI:10072 |
| KEGG | C02470 |
| HMDb | HMDB00881 |
| PubChem | 5699 |
| Wikipedia | Xanthurenic acid |
| ChemSpider | 5497 |